2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)
Modify Date: 2025-09-15 21:33:22
2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) structure
|
Common Name | 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 41964-93-6 | Molecular Weight | 165.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO |
|---|---|
| Molecular Weight | 165.23 |
| InChIKey | SQAPBMXPROXHMR-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(C)C)c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 41964-93-6? |
| A: Chinese name of 41964-93-6 is 41964-93-6. |
| Q: What is the SMILES notation of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: SMILES notation of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is CCc1ccc(C(C)C)c(=O)[nH]1. |
| Q: What is the English name of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: The English name of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl). |
| Q: What is the CAS number of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: CAS number of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is 41964-93-6. |
| Q: What is the molecular formula of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: Molecular formula of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is C10H15NO. |
| Q: What is the molecular weight of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: Molecular weight of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is 165.23. |
| Q: What is the InChIKey of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl)? |
| A: InChIKey of 2(1H)-Pyridinone, 6-ethyl-3-(1-methylethyl) is SQAPBMXPROXHMR-UHFFFAOYSA-N. |