(3,3-Dimethylbutyl)(triethoxy)silane structure
|
Common Name | (3,3-Dimethylbutyl)(triethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 41966-94-3 | Molecular Weight | 248.434 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 199.6±8.0 °C at 760 mmHg | |
| Molecular Formula | C12H28O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.6±19.0 °C | |
| Name | 3,3-dimethylbutyl(triethoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 199.6±8.0 °C at 760 mmHg |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.434 |
| Flash Point | 84.6±19.0 °C |
| Exact Mass | 248.180771 |
| PSA | 27.69000 |
| LogP | 4.02 |
| Vapour Pressure | 0.5±0.4 mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | DVQGJDYDHQULIU-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCC(C)(C)C)(OCC)OCC |
| HS Code | 2931900090 |
|---|
|
~%
(3,3-Dimethylbu... CAS#:41966-94-3 |
| Literature: Bai, Ying; Peng, Jiajian; Li, Jiayun; Lai, Guoqiao Applied Organometallic Chemistry, 2011 , vol. 25, # 5 p. 400 - 405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (3,3-dimethylbutyl)triethoxysilane |
| (3,3-Dimethylbutyl)(triethoxy)silane |
| Silane, (3,3-dimethylbutyl)triethoxy- |
| 2,2-dimethyl-4-(3,5-dimethyl-4-methoxyphenyl)-4-oxobutyric acid |