3-[(2-methyl-allyloxyimino)-methyl]-rifamycin
Modify Date: 2025-09-13 18:22:50
![3-[(2-methyl-allyloxyimino)-methyl]-rifamycin Structure](https://image.chemsrc.com/caspic/186/41970-69-8.png)
3-[(2-methyl-allyloxyimino)-methyl]-rifamycin structure
|
Common Name | 3-[(2-methyl-allyloxyimino)-methyl]-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 41970-69-8 | Molecular Weight | 794.88400 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C42H54N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2-methyl-allyloxyimino)-methyl]-rifamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C42H54N2O13 |
| Molecular Weight | 794.88400 |
| Exact Mass | 794.36300 |
| PSA | 222.90000 |
| LogP | 5.43830 |
| Index of Refraction | 1.607 |
| InChIKey | VMFGVCZXVUPFIS-DHYLSXSXSA-N |
| SMILES | C=C(C)CON=Cc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
3-[(2-methyl-al... CAS#:41970-69-8 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Formylrifamycin SV-O-i-butenyloxim |