3-[(4-phenoxy-butoxyimino)-methyl]-rifamycin
Modify Date: 2025-09-26 16:17:01
![3-[(4-phenoxy-butoxyimino)-methyl]-rifamycin Structure](https://image.chemsrc.com/caspic/076/41970-81-4.png)
3-[(4-phenoxy-butoxyimino)-methyl]-rifamycin structure
|
Common Name | 3-[(4-phenoxy-butoxyimino)-methyl]-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 41970-81-4 | Molecular Weight | 888.99500 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C48H60N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(4-phenoxy-butoxyimino)-methyl]-rifamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C48H60N2O14 |
| Molecular Weight | 888.99500 |
| Exact Mass | 888.40400 |
| PSA | 232.13000 |
| LogP | 6.72140 |
| Index of Refraction | 1.618 |
| InChIKey | XYBDTTAVFVQQHY-VSDHPOHISA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(C=NOCCCCOc5ccccc5)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
3-[(4-phenoxy-b... CAS#:41970-81-4 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Formylrifamycin SV-O-phenoxybutyloxim |