1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester
Modify Date: 2026-07-12 23:19:39
1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester structure
|
Common Name | 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 41979-42-4 | Molecular Weight | 247.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.29 |
| InChIKey | QFLJECRTBQCNTI-UHFFFAOYSA-N |
| SMILES | CCC1CN(C(=O)Oc2ccccc2)CCC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: CAS number of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is 41979-42-4. |
| Q: What is the SMILES notation of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: SMILES notation of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is CCC1CN(C(=O)Oc2ccccc2)CCC1=O. |
| Q: What is the molecular weight of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: Molecular weight of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is 247.29. |
| Q: What is the InChIKey of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: InChIKey of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is QFLJECRTBQCNTI-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: The English name of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester. |
| Q: What is the molecular formula of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester? |
| A: Molecular formula of 1-Piperidinecarboxylic acid, 3-ethyl-4-oxo-, phenyl ester is C14H17NO3. |
| Q: What is the Chinese name of 41979-42-4? |
| A: Chinese name of 41979-42-4 is 41979-42-4. |