L-Arginine malate
Modify Date: 2024-01-09 18:04:29
L-Arginine malate structure
|
Common Name | L-Arginine malate | ||
|---|---|---|---|---|
| CAS Number | 41989-03-1 | Molecular Weight | 308.288 | |
| Density | N/A | Boiling Point | 409.1ºC at 760mmHg | |
| Molecular Formula | C10H20N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid,2-hydroxybutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 409.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H20N4O7 |
| Molecular Weight | 308.288 |
| Flash Point | 201.2ºC |
| Exact Mass | 308.133209 |
| PSA | 220.05000 |
| InChIKey | RUFJTBOKWJYXPM-WDIAKOBKSA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)CC(O)C(=O)O |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Rocmalate |
| UNII-4ZWH2B7Q0Q |
| Arginine malate |
| L-Arginine L-malate |
| L-Arginine malate |
| L-Arginine,hydroxybutanedioate |
| L-Arginine - 2-hydroxysuccinic acid (1:1) |
| L-Arginine, compd. with 2-hydroxybutanedioic acid (1:1) |