tris-decyl phosphate structure
|
Common Name | tris-decyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 4200-55-9 | Molecular Weight | 518.79300 | |
| Density | 0.915g/cm3 | Boiling Point | 470.3ºC at 760 mmHg | |
| Molecular Formula | C30H63O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris-decyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.915g/cm3 |
|---|---|
| Boiling Point | 470.3ºC at 760 mmHg |
| Molecular Formula | C30H63O4P |
| Molecular Weight | 518.79300 |
| Exact Mass | 518.44600 |
| PSA | 54.57000 |
| LogP | 11.56640 |
| Index of Refraction | 1.452 |
| InChIKey | KUHPLTBUBAGTDV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOP(=O)(OCCCCCCCCCC)OCCCCCCCCCC |
| HS Code | 2919900090 |
|---|
|
~%
tris-decyl phosphate CAS#:4200-55-9 |
| Literature: Monsanto Chem.Co. Patent: US2573658 , 1949 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Tridecylphosphat |
| tridecyl phosphate |
| tri-n-decyl phosphate |
| EINECS 224-099-7 |
| Phosphorsaeure-tridecylester |
| Phosphoric Acid Trisdecyl Ester |
| phosphoric acid tridecyl ester |