benzylO-benzyl-L-threoninate
Modify Date: 2026-09-22 09:45:03
benzylO-benzyl-L-threoninate structure
|
Common Name | benzylO-benzyl-L-threoninate | ||
|---|---|---|---|---|
| CAS Number | 42001-91-2 | Molecular Weight | 299.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzylO-benzyl-L-threoninate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO3 |
|---|---|
| Molecular Weight | 299.36400 |
| Exact Mass | 299.15200 |
| PSA | 61.55000 |
| LogP | 3.36270 |
| InChIKey | JFGFSGAITLXWHG-PBHICJAKSA-N |
| SMILES | CC(OCc1ccccc1)C(N)C(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:69863-36-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzylO-benzyl-L-threoninate? |
| A: CAS number of benzylO-benzyl-L-threoninate is 42001-91-2. |
| Q: What is the English name of benzylO-benzyl-L-threoninate? |
| A: The English name of benzylO-benzyl-L-threoninate is benzylO-benzyl-L-threoninate. |
| Q: What is the InChIKey of benzylO-benzyl-L-threoninate? |
| A: InChIKey of benzylO-benzyl-L-threoninate is JFGFSGAITLXWHG-PBHICJAKSA-N. |
| Q: What is the molecular weight of benzylO-benzyl-L-threoninate? |
| A: Molecular weight of benzylO-benzyl-L-threoninate is 299.36400. |
| Q: What is the molecular formula of benzylO-benzyl-L-threoninate? |
| A: Molecular formula of benzylO-benzyl-L-threoninate is C18H21NO3. |
| Q: What is the LogP of benzylO-benzyl-L-threoninate? |
| A: LogP of benzylO-benzyl-L-threoninate is 3.36270. |
| Q: What is the Chinese name of 42001-91-2? |
| A: Chinese name of 42001-91-2 is 42001-91-2. |
| Q: What is the polar surface area (PSA) of benzylO-benzyl-L-threoninate? |
| A: Polar surface area (PSA) of benzylO-benzyl-L-threoninate is 61.55000. |
| Q: What is the SMILES notation of benzylO-benzyl-L-threoninate? |
| A: SMILES notation of benzylO-benzyl-L-threoninate is CC(OCc1ccccc1)C(N)C(=O)OCc1ccccc1. |
| Q: What are the downstream products of benzylO-benzyl-L-threoninate? |
| A: Related downstream products(CAS) of benzylO-benzyl-L-threoninate: 69863-36-1. |