3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid
Modify Date: 2024-01-31 17:36:41
3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid structure
|
Common Name | 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 420101-13-9 | Molecular Weight | 281.26300 | |
| Density | 1.438g/cm3 | Boiling Point | 534.6ºC at 760 mmHg | |
| Molecular Formula | C16H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoic acid |
|---|
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 534.6ºC at 760 mmHg |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.26300 |
| Flash Point | 277.1ºC |
| Exact Mass | 281.06900 |
| PSA | 74.68000 |
| LogP | 2.55880 |
| Index of Refraction | 1.679 |
| InChIKey | ANMZERJXLKKHDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |