2,2,2-trifluoro-N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]acetamide structure
|
Common Name | 2,2,2-trifluoro-N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 42011-48-3 | Molecular Weight | 307.20600 | |
| Density | 1.692g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H4F3N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|
| Density | 1.692g/cm3 |
|---|---|
| Molecular Formula | C9H4F3N3O4S |
| Molecular Weight | 307.20600 |
| Exact Mass | 306.98700 |
| PSA | 132.68000 |
| LogP | 3.98480 |
| Index of Refraction | 1.585 |
| InChIKey | GMHPROGCQPQRLG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc(-c2ccc([N+](=O)[O-])o2)cs1)C(F)(F)F |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |