(-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride
Modify Date: 2026-07-04 12:10:59
(-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride structure
|
Common Name | (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 42011-76-7 | Molecular Weight | 259.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22ClNO2 |
|---|---|
| Molecular Weight | 259.77 |
| InChIKey | NFWFNZNUXAZEQG-SBSPUUFOSA-N |
| SMILES | CCc1cc(OC)c(CC(C)N)cc1OC.Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 51, Current Page 1 of 6
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 42011-76-7? |
| A: Chinese name of 42011-76-7 is 42011-76-7. |
| Q: What is the InChIKey of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: InChIKey of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is NFWFNZNUXAZEQG-SBSPUUFOSA-N. |
| Q: What is the SMILES notation of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: SMILES notation of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is CCc1cc(OC)c(CC(C)N)cc1OC.Cl. |
| Q: What is the molecular weight of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: Molecular weight of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is 259.77. |
| Q: What is the English name of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: The English name of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride. |
| Q: What is the molecular formula of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: Molecular formula of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is C13H22ClNO2. |
| Q: What is the CAS number of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride? |
| A: CAS number of (-)-2,5-Dimethoxy-4-ethylamphetamine hydrochloride is 42011-76-7. |