sodium,2-[4-(cyclopropanecarbonyl)phenyl]acetate structure
|
Common Name | sodium,2-[4-(cyclopropanecarbonyl)phenyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 42011-88-1 | Molecular Weight | 226.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-[4-(cyclopropanecarbonyl)phenyl]acetate |
|---|
| Molecular Formula | C12H11NaO3 |
|---|---|
| Molecular Weight | 226.20400 |
| Exact Mass | 226.06100 |
| PSA | 57.20000 |
| LogP | 0.57170 |
| InChIKey | PTGIFZNRQRICAL-UHFFFAOYSA-M |
| SMILES | O=C([O-])Cc1ccc(C(=O)C2CC2)cc1.[Na+] |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |