2-(2-benzoylphenoxy)-N-phenylacetamide
Modify Date: 2025-08-25 21:49:59
2-(2-benzoylphenoxy)-N-phenylacetamide structure
|
Common Name | 2-(2-benzoylphenoxy)-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 42018-53-1 | Molecular Weight | 331.36500 | |
| Density | 1.231g/cm3 | Boiling Point | 582.2ºC at 760 mmHg | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.9ºC | |
| Name | 2-(2-benzoylphenoxy)-N-phenylacetamide |
|---|
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 582.2ºC at 760 mmHg |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.36500 |
| Flash Point | 305.9ºC |
| Exact Mass | 331.12100 |
| PSA | 58.89000 |
| LogP | 4.58460 |
| Index of Refraction | 1.637 |
| InChIKey | LMGAWXBXENCNPE-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |