2-[4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone
Modify Date: 2025-08-25 20:48:04
![2-[4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone Structure](https://image.chemsrc.com/caspic/370/42018-72-4.png)
2-[4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone structure
|
Common Name | 2-[4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 42018-72-4 | Molecular Weight | 338.40000 | |
| Density | 1.185g/cm3 | Boiling Point | 558.124ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 558.124ºC at 760 mmHg |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.40000 |
| Exact Mass | 338.16300 |
| PSA | 62.13000 |
| LogP | 3.24240 |
| Index of Refraction | 1.596 |
| InChIKey | WMYVMTBSZIBCEV-QZQOTICOSA-N |
| SMILES | O=C(COc1ccc(C(=NO)c2ccccc2)cc1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzophenone,4-piperidinocarbonylmethoxy-,oxime |