methyl 7-[(3S)-3-hydroxy-5-oxocyclopenten-1-yl]heptanoate structure
|
Common Name | methyl 7-[(3S)-3-hydroxy-5-oxocyclopenten-1-yl]heptanoate | ||
|---|---|---|---|---|
| CAS Number | 42038-75-5 | Molecular Weight | 240.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 378.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O4 | Melting Point | 59-62ºC | |
| MSDS | USA | Flash Point | 138.9±21.4 °C | |
| Name | methyl 7-[(3S)-3-hydroxy-5-oxocyclopenten-1-yl]heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.4±42.0 °C at 760 mmHg |
| Melting Point | 59-62ºC |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.296 |
| Flash Point | 138.9±21.4 °C |
| Exact Mass | 240.136154 |
| PSA | 63.60000 |
| LogP | 0.65 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | PQKUWAVOSCVDCT-LLVKDONJSA-N |
| SMILES | COC(=O)CCCCCCC1=CC(O)CC1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~41%
methyl 7-[(3S)-... CAS#:42038-75-5 |
| Literature: Rodriguez, Ana; Nomen, Miguel; Spur, Bernd Werner; Godfroid, Jean-Jacques European Journal of Organic Chemistry, 1999 , # 10 p. 2655 - 2662 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| q134 |
| Methyl 7-[(3S)-3-hydroxy-5-oxo-1-cyclopenten-1-yl]heptanoate |
| unii-ajc415l6rx |
| MFCD00799562 |
| Methyl 7-[(3S)-3-hydroxy-5-oxocyclopent-1-en-1-yl]heptanoate |