N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide structure
|
Common Name | N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide | ||
|---|---|---|---|---|
| CAS Number | 4204-30-2 | Molecular Weight | 353.86500 | |
| Density | 1.29g/cm3 | Boiling Point | 542.1ºC at 760 mmHg | |
| Molecular Formula | C20H16ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.7ºC | |
| Name | N-(2-chlorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 542.1ºC at 760 mmHg |
| Molecular Formula | C20H16ClNOS |
| Molecular Weight | 353.86500 |
| Flash Point | 281.7ºC |
| Exact Mass | 353.06400 |
| PSA | 57.89000 |
| LogP | 6.46160 |
| Index of Refraction | 1.67 |
| InChIKey | UUSINBDCVHACIR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Cl)C(Sc1ccccc1)c1ccccc1 |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |