(4-prop-2-enylphenyl) benzoate structure
|
Common Name | (4-prop-2-enylphenyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 4204-49-3 | Molecular Weight | 238.28100 | |
| Density | 1.096g/cm3 | Boiling Point | 356.9ºC at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-prop-2-enylphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 356.9ºC at 760 mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Exact Mass | 238.09900 |
| PSA | 26.30000 |
| LogP | 3.63430 |
| Index of Refraction | 1.575 |
| InChIKey | PJUDEPFOHLENKM-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(OC(=O)c2ccccc2)cc1 |
| HS Code | 2916310090 |
|---|
|
~69%
(4-prop-2-enylp... CAS#:4204-49-3 |
| Literature: Diaz-Alvarez, Alba E.; Crochet, Pascale; Cadierno, Victorio Tetrahedron, 2012 , vol. 68, # 12 p. 2611 - 2620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| benzoyl lusitanicol |
| 4-Allylphenyl benzoate |