(2E)-3-(6-chloro-4-oxo-4H-chromen-3-yl)acrylic acid() structure
|
Common Name | (2E)-3-(6-chloro-4-oxo-4H-chromen-3-yl)acrylic acid() | ||
|---|---|---|---|---|
| CAS Number | 42059-70-1 | Molecular Weight | 250.63500 | |
| Density | 1.59g/cm3 | Boiling Point | 411.5ºC at 760 mmHg | |
| Molecular Formula | C12H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | (2E)-3-(6-chloro-4-oxo-4H-chromen-3-yl)acrylic acid() |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760 mmHg |
| Molecular Formula | C12H7ClO4 |
| Molecular Weight | 250.63500 |
| Flash Point | 202.6ºC |
| Exact Mass | 250.00300 |
| PSA | 67.51000 |
| LogP | 2.54420 |
| Index of Refraction | 1.716 |
| InChIKey | NCCZLKPUVIPKBT-DAFODLJHSA-N |
| SMILES | O=C(O)C=Cc1coc2ccc(Cl)cc2c1=O |
| HS Code | 2918300090 |
|---|
|
~17%
(2E)-3-(6-chlor... CAS#:42059-70-1
Detail
|
| Literature: Shutov, Roman V.; Kuklina, Elizaveta V.; Ivin, Boris A. Tetrahedron Letters, 2011 , vol. 52, # 2 p. 266 - 269 |
|
~92%
(2E)-3-(6-chlor... CAS#:42059-70-1 |
| Literature: Suresh, Dhruva Kumar; Sandhu, Jagir S. Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2011 , vol. 50, # 10 p. 1479 - 1483 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| rarechem al bk 0740 |