Biphenyl-4-yl piperidin-4-yl methanone structure
|
Common Name | Biphenyl-4-yl piperidin-4-yl methanone | ||
|---|---|---|---|---|
| CAS Number | 42060-83-3 | Molecular Weight | 265.350 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 428.5±38.0 °C at 760 mmHg | |
| Molecular Formula | C18H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.5±26.9 °C | |
| Name | (4-phenylphenyl)-piperidin-4-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.5±38.0 °C at 760 mmHg |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.350 |
| Flash Point | 155.5±26.9 °C |
| Exact Mass | 265.146667 |
| PSA | 29.10000 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | MEAYERISLPBAKL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C1CCNCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-Biphenylyl-4-piperidylketon |
| 4-Biphenylyl(4-piperidinyl)methanone |
| Biphenyl-4-yl-piperidin-4-yl-methanone |
| Methanone, [1,1'-biphenyl]-4-yl-4-piperidinyl- |
| P-BIPHENYLYL 4-PIPERIDYL KETONE |