N-[1-hydroxy-2-(4-methoxyphenyl)-2-oxoethyl]pyridine-3-carboxamide
Modify Date: 2025-09-21 14:22:52
![N-[1-hydroxy-2-(4-methoxyphenyl)-2-oxoethyl]pyridine-3-carboxamide Structure](https://image.chemsrc.com/caspic/016/42069-26-1.png)
N-[1-hydroxy-2-(4-methoxyphenyl)-2-oxoethyl]pyridine-3-carboxamide structure
|
Common Name | N-[1-hydroxy-2-(4-methoxyphenyl)-2-oxoethyl]pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 42069-26-1 | Molecular Weight | 286.28300 | |
| Density | 1.296g/cm3 | Boiling Point | 595.9ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.2ºC | |
| Name | N-[1-hydroxy-2-(4-methoxyphenyl)-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 595.9ºC at 760 mmHg |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.28300 |
| Flash Point | 314.2ºC |
| Exact Mass | 286.09500 |
| PSA | 92.01000 |
| LogP | 1.59610 |
| Index of Refraction | 1.601 |
| InChIKey | LZQNQDGIOMAUIG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(O)NC(=O)c2cccnc2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methoxyphenylglyoxal nicotinamido-hemiacetal |