2,2-dimethyl-1-methylsulfanyl-propan-1-one
Modify Date: 2024-01-10 12:02:03
2,2-dimethyl-1-methylsulfanyl-propan-1-one structure
|
Common Name | 2,2-dimethyl-1-methylsulfanyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 42075-46-7 | Molecular Weight | 132.22400 | |
| Density | 0.953g/cm3 | Boiling Point | 151.4ºC at 760 mmHg | |
| Molecular Formula | C6H12OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.2ºC | |
| Name | bis(2-bromophenyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 151.4ºC at 760 mmHg |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.22400 |
| Flash Point | 39.2ºC |
| Exact Mass | 132.06100 |
| PSA | 42.37000 |
| LogP | 1.92210 |
| Index of Refraction | 1.457 |
|
~%
2,2-dimethyl-1-... CAS#:42075-46-7 |
| Literature: Reitz,D.B. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 5428 - 5436 |
|
~%
2,2-dimethyl-1-... CAS#:42075-46-7 |
| Literature: Seyferth, Dietmar; Hui, Richard C. Tetrahedron Letters, 1984 , vol. 25, # 25 p. 2623 - 2626 |
| S-methyl 2,2-dimethylthiopropionate |
| Methylthiopivalat |
| Cyclohexanecarbothioic acid,1-hydroxy-,S-methyl ester |
| S-methyl 1-hydroxy-1-cyclohexanethiocarboxylate |
| S-methyl 1-hydroxycyclohexanecarbothioate |
| 1-hydroxy-cyclohexane-1-carbothioic acid S-methyl ester |
| S-methyl thiopivaloate |