3,7-Dimethyl-1,5-diphenyl-3,7-diazabicyclo(3.3.1)nonan-9-one structure
|
Common Name | 3,7-Dimethyl-1,5-diphenyl-3,7-diazabicyclo(3.3.1)nonan-9-one | ||
|---|---|---|---|---|
| CAS Number | 4208-34-8 | Molecular Weight | 320.42800 | |
| Density | 1.156g/cm3 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | 3,7-dimethyl-1,5-diphenyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.42800 |
| Flash Point | 197.2ºC |
| Exact Mass | 320.18900 |
| PSA | 23.55000 |
| LogP | 2.19810 |
| Index of Refraction | 1.606 |
| InChIKey | SXWZIHPBPHHLQI-UHFFFAOYSA-N |
| SMILES | CN1CC2(c3ccccc3)CN(C)CC(c3ccccc3)(C1)C2=O |
| HS Code | 2933990090 |
|---|
|
~72%
3,7-Dimethyl-1,... CAS#:4208-34-8 |
| Literature: Black, David St. C.; Deacon, Glen B.; Rose, Michael Tetrahedron, 1995 , vol. 51, # 7 p. 2055 - 2076 |
|
~%
3,7-Dimethyl-1,... CAS#:4208-34-8 |
| Literature: Kyi; Wilson Journal of the Chemical Society, 1951 , p. 1706 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-dimethyl-1,5-diphenylbispydone-9 |
| 1,5-diphenyl-3,7-dimethyl-3,7-diazabicyclo<3.3.1>nonan-9-one |
| HMS1373P15 |
| 3,7-dimethyl-1,5-diphenyl-3,7-diazabicyclo<3.3.1>nonane-9-one |
| 3,7-dimethyl-1,5-diphenyl-3,7-diaza-bicyclo[3.3.1]nonan-9-one |
| 3,7-Dimethyl-1,5-diphenyl-3,7-diaza-bicyclo[3.3.1]nonan-9-on |