(5-(((Methylsulfonyl)oxy)methyl)-2-oxido-1,3,2-dioxathiolan-4-yl)methyl methanesulfonate structure
|
Common Name | (5-(((Methylsulfonyl)oxy)methyl)-2-oxido-1,3,2-dioxathiolan-4-yl)methyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 4211-07-8 | Molecular Weight | 324.34900 | |
| Density | 1.74g/cm3 | Boiling Point | 584.8ºC at 760 mmHg | |
| Molecular Formula | C6H12O9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.5ºC | |
| Name | [5-(methylsulfonyloxymethyl)-2-oxo-1,3,2-dioxathiolan-4-yl]methyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 584.8ºC at 760 mmHg |
| Molecular Formula | C6H12O9S3 |
| Molecular Weight | 324.34900 |
| Flash Point | 307.5ºC |
| Exact Mass | 323.96400 |
| PSA | 158.24000 |
| LogP | 1.32880 |
| Index of Refraction | 1.572 |
| InChIKey | NUIVNAIWDLKFPS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1OS(=O)OC1COS(C)(=O)=O |
| HS Code | 2934999090 |
|---|
|
~%
(5-(((Methylsul... CAS#:4211-07-8 |
| Literature: Feit,P.W. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 241 - 242 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-4,5-Bismethylsulfonyloxymethyl-1,3,2-dioxathiolane 2-Oxide |