1,2,3,4,5-pentachloro-6-(2,3-dibromopropoxy)benzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-(2,3-dibromopropoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 42115-16-2 | Molecular Weight | 466.20800 | |
| Density | 2.001g/cm3 | Boiling Point | 461.8ºC at 760mmHg | |
| Molecular Formula | C9H5Br2Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | 1,2,3,4,5-pentachloro-6-(2,3-dibromopropoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.001g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760mmHg |
| Molecular Formula | C9H5Br2Cl5O |
| Molecular Weight | 466.20800 |
| Flash Point | 233.1ºC |
| Exact Mass | 461.71500 |
| PSA | 9.23000 |
| LogP | 6.49080 |
| Index of Refraction | 1.622 |
| InChIKey | ICFSXGHJHAOHRV-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c(OCC(Br)CBr)c(Cl)c1Cl |
| HS Code | 2909309090 |
|---|
|
~%
1,2,3,4,5-penta... CAS#:42115-16-2 |
| Literature: Felton; McLaughlin Journal of Organic Chemistry, 1947 , vol. 12, p. 298,299 |
|
~%
1,2,3,4,5-penta... CAS#:42115-16-2 |
| Literature: Felton; McLaughlin Journal of Organic Chemistry, 1947 , vol. 12, p. 298,299 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| einecs 255-659-9 |