D-xylulose 5-phosphate structure
|
Common Name | D-xylulose 5-phosphate | ||
|---|---|---|---|---|
| CAS Number | 4212-65-1 | Molecular Weight | 230.11000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H11O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | D-xylulose 5-phosphate |
|---|
| Molecular Formula | C5H11O8P |
|---|---|
| Molecular Weight | 230.11000 |
| Exact Mass | 230.01900 |
| PSA | 154.33000 |
| InChIKey | FNZLKVNUWIIPSJ-RFZPGFLSSA-N |
| SMILES | O=C(CO)C(O)C(O)COP(=O)(O)O |
| HS Code | 2919900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |