Acetic acid, [3-[bis (2-chloroethyl)amino]phenoxy]- (8CI 9CI) structure
|
Common Name | Acetic acid, [3-[bis (2-chloroethyl)amino]phenoxy]- (8CI 9CI) | ||
|---|---|---|---|---|
| CAS Number | 4213-29-0 | Molecular Weight | 292.15800 | |
| Density | 1.338g/cm3 | Boiling Point | 434.8ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | 2-[3-[bis(2-chloroethyl)amino]phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 434.8ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.15800 |
| Flash Point | 216.8ºC |
| Exact Mass | 291.04300 |
| PSA | 49.77000 |
| LogP | 2.43400 |
| Index of Refraction | 1.577 |
| InChIKey | UZTZPJJLKNUFLV-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cccc(N(CCCl)CCCl)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (m-<Bis-(2-chlorethyl)-amino>-phenoxy)-essigsaeure |
| {3-[bis(2-chloroethyl)amino]phenoxy}acetic acid |
| MP 543 |