3-anilino-4-ethoxycyclobut-3-ene-1,2-dione structure
|
Common Name | 3-anilino-4-ethoxycyclobut-3-ene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 42132-09-2 | Molecular Weight | 217.22100 | |
| Density | 1.26g/cm3 | Boiling Point | 359.6ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | 3-anilino-4-ethoxycyclobut-3-ene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 171.3ºC |
| Exact Mass | 217.07400 |
| PSA | 55.40000 |
| LogP | 1.57140 |
| Index of Refraction | 1.587 |
| InChIKey | WJHCIIWYNPNBMY-UHFFFAOYSA-N |
| SMILES | CCOc1c(Nc2ccccc2)c(=O)c1=O |
| Storage condition | 2-8°C |
| HS Code | 2922509090 |
|---|
|
~94%
3-anilino-4-eth... CAS#:42132-09-2 |
| Literature: Jin, Can; Zhang, Man; Deng, Chao; Guan, Yangfan; Gong, Jun; Zhu, Dunru; Pan, Yi; Jiang, Juli; Wang, Leyong Tetrahedron Letters, 2013 , vol. 54, # 8 p. 796 - 801 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Quadratsaeure-ethylester-anilid |
| 3-(phenylamino)-4-ethoxycyclobut-3-ene-1,2-dione |
| 1-Anilino-2-aethoxycyclobuten-3.4-dion |
| 3-(ethoxy)-4-(phenylamino)-3-cyclobutene-1,2-dione |
| 3-ethoxy-4-(phenylamino)cyclobut-3-ene-1,2-dione |