4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid structure
|
Common Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 42142-70-1 | Molecular Weight | 266.20700 | |
| Density | 1.528g/cm3 | Boiling Point | 496.4ºC at 760mmHg | |
| Molecular Formula | C11H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid |
|---|
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760mmHg |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.20700 |
| Flash Point | 254ºC |
| Exact Mass | 266.05400 |
| PSA | 118.26000 |
| LogP | 1.89070 |
| Index of Refraction | 1.62 |
| InChIKey | HSELHMHPLWKBID-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| HS Code | 2934999090 |
|---|
|
~%
4-(6-nitro-2-ox... CAS#:42142-70-1 |
| Literature: Eshimbetov,Z. et al. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1973 , vol. 9, p. 428 - 430 Khimiya Geterotsiklicheskikh Soedinenii, 1973 , vol. 9, p. 464 - 466 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |