1,1,1,2,3,3-hexachloro-2-fluoro-propane
1,1,1,2,3,3-hexachloro-2-fluoro-propane structure
|
Common Name | 1,1,1,2,3,3-hexachloro-2-fluoro-propane | ||
|---|---|---|---|---|
| CAS Number | 422-40-2 | Molecular Weight | 268.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3HCl6F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,3,3-hexachloro-2-fluoro-propane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C3HCl6F |
|---|---|
| Molecular Weight | 268.75600 |
| Exact Mass | 265.81900 |
| LogP | 4.06490 |
| InChIKey | MIWPCXOKPJVIGA-UHFFFAOYSA-N |
| SMILES | FC(Cl)(C(Cl)Cl)C(Cl)(Cl)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:815-15-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1,2,3,3-Hexachlor-2-fluor-propan |
| 1,1,1,2,3,3-hexachloro-2-fluoropropane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: Molecular formula of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is C3HCl6F. |
| Q: What is the CAS number of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: CAS number of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is 422-40-2. |
| Q: What is the Chinese name of 422-40-2? |
| A: Chinese name of 422-40-2 is 422-40-2. |
| Q: What are the downstream products of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: Related downstream products(CAS) of 1,1,1,2,3,3-hexachloro-2-fluoro-propane: 815-15-6. |
| Q: What is the molecular weight of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: Molecular weight of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is 268.75600. |
| Q: What is the LogP of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: LogP of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is 4.06490. |
| Q: What is the English name of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: The English name of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is 1,1,1,2,3,3-hexachloro-2-fluoro-propane. |
| Q: What is the InChIKey of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: InChIKey of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is MIWPCXOKPJVIGA-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,1,1,2,3,3-hexachloro-2-fluoro-propane have? |
| A: English synonyms of 1,1,1,2,3,3-hexachloro-2-fluoro-propane: 1,1,1,2,3,3-Hexachlor-2-fluor-propan, 1,1,1,2,3,3-hexachloro-2-fluoropropane. |
| Q: What is the SMILES notation of 1,1,1,2,3,3-hexachloro-2-fluoro-propane? |
| A: SMILES notation of 1,1,1,2,3,3-hexachloro-2-fluoro-propane is FC(Cl)(C(Cl)Cl)C(Cl)(Cl)Cl. |