diethyl 2-oxoheptane-1,7-dicarboxylate
Modify Date: 2025-08-27 11:24:07
diethyl 2-oxoheptane-1,7-dicarboxylate structure
|
Common Name | diethyl 2-oxoheptane-1,7-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 42212-75-9 | Molecular Weight | 230.25800 | |
| Density | 1.075g/cm3 | Boiling Point | 302.9ºC at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.1ºC | |
| Name | diethyl 2-oxoheptane-1,7-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 302.9ºC at 760 mmHg |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.25800 |
| Flash Point | 129.1ºC |
| Exact Mass | 230.11500 |
| PSA | 69.67000 |
| LogP | 1.24210 |
| Index of Refraction | 1.441 |
| InChIKey | HLKMXFSQQZYBEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)C(=O)OCC |
| HS Code | 2918300090 |
|---|
|
~41%
diethyl 2-oxohe... CAS#:42212-75-9 |
| Literature: Cushman, Mark; Yang, Donglai; Gerhardt, Stefan; Huber, Robert; Fischer, Markus; Kis, Klaus; Bacher, Adelbert Journal of Organic Chemistry, 2002 , vol. 67, # 16 p. 5807 - 5816 |
|
~%
diethyl 2-oxohe... CAS#:42212-75-9 |
| Literature: Burks, Elizabeth A.; Johnson Jr., William H.; Whitman, Christian P. Journal of the American Chemical Society, 1998 , vol. 120, # 31 p. 7665 - 7675 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| oxo-2 pimelate d'ethyle |
| 2-Oxopentanoic acid ethyl ester |
| ethyl 2-oxopentoate |
| Ethyl 2-oxo-pentanoate |
| Ethyl 2-oxovalerate |
| ethyl oxopentanoate |
| 2-oxo-valeric acid ethyl ester |
| ethyl 2-oxo-pimelate |
| diethyl 2-oxopimelate |
| Pentanoic acid,2-oxo-,ethyl ester |
| 2-Oxo-valeriansaeure-aethylester |