2-(3-oxo-3-phenylpropanoyl)benzoic acid structure
|
Common Name | 2-(3-oxo-3-phenylpropanoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 42222-79-7 | Molecular Weight | 268.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-oxo-3-phenylpropanoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O4 |
|---|---|
| Molecular Weight | 268.26400 |
| Exact Mass | 268.07400 |
| PSA | 71.44000 |
| LogP | 2.84050 |
| InChIKey | SHAPIWXATZPBGB-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1C(=O)O)c1ccccc1 |
|
~85%
2-(3-oxo-3-phen... CAS#:42222-79-7 |
| Literature: Hori, Kimihiko; Takaishi, Naotake Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 1791 - 1792 |
|
~83%
2-(3-oxo-3-phen... CAS#:42222-79-7 |
| Literature: Kao Corporation Patent: US4670585 A1, 1987 ; |
|
~%
2-(3-oxo-3-phen... CAS#:42222-79-7 |
| Literature: Schwerin Chemische Berichte, 1894 , vol. 27, p. 108 |
| 2-carboxydibenzoylmethane |