2-(diethylamino)ethyl 4-methylpiperazine-1-carboxylate
Modify Date: 2025-10-10 13:45:59
2-(diethylamino)ethyl 4-methylpiperazine-1-carboxylate structure
|
Common Name | 2-(diethylamino)ethyl 4-methylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 4223-93-2 | Molecular Weight | 243.34600 | |
| Density | 1.031g/cm3 | Boiling Point | 318.5ºC at 760 mmHg | |
| Molecular Formula | C12H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.4ºC | |
| Name | 2-(diethylamino)ethyl 4-methylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 318.5ºC at 760 mmHg |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.34600 |
| Flash Point | 146.4ºC |
| Exact Mass | 243.19500 |
| PSA | 36.02000 |
| LogP | 0.58800 |
| Index of Refraction | 1.489 |
| InChIKey | GBQWCNJINWMNPV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)N1CCN(C)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
2-(diethylamino... CAS#:4223-93-2 |
| Literature: Am. Cyanamid Co. Patent: US2617803 , 1949 ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Diethylaminoethyl 4-methylpiperazine-1-carboxylate |
| 2-Diaethylaminoaethyl-4-methylpiperazin-1-carboxylat |