4,7-dichloro-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 4,7-dichloro-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 4228-89-1 | Molecular Weight | 255.02400 | |
| Density | 1.672g/cm3 | Boiling Point | 332.3ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.8ºC | |
| Name | 4,7-dichloro-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672g/cm3 |
|---|---|
| Boiling Point | 332.3ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2F3N2 |
| Molecular Weight | 255.02400 |
| Flash Point | 154.8ºC |
| Exact Mass | 253.96300 |
| PSA | 28.68000 |
| LogP | 3.88850 |
| Index of Refraction | 1.588 |
| InChIKey | QECRKWYIIQPMPA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc2c(Cl)ccc(Cl)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-dichloro-2-trifluoromethyl-1H-benzoimidazole |
| 4,7-Dichlor-2-trifluormethyl-benzimidazol |