4,5,7-trichloro-6-methyl-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 4,5,7-trichloro-6-methyl-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 4228-99-3 | Molecular Weight | 303.49600 | |
| Density | 1.679g/cm3 | Boiling Point | 382.7ºC at 760 mmHg | |
| Molecular Formula | C9H4Cl3F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | 4,5,7-trichloro-6-methyl-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.679g/cm3 |
|---|---|
| Boiling Point | 382.7ºC at 760 mmHg |
| Molecular Formula | C9H4Cl3F3N2 |
| Molecular Weight | 303.49600 |
| Flash Point | 185.2ºC |
| Exact Mass | 301.93900 |
| PSA | 28.68000 |
| LogP | 4.85030 |
| Index of Refraction | 1.591 |
| InChIKey | FTDIVRFRWTWDKU-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6,7-Trichlor-5-methyl-2-trifluormethyl-benzimidazol |