1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexane structure
|
Common Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 423-02-9 | Molecular Weight | 450.06800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9F18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9F18 |
|---|---|
| Molecular Weight | 450.06800 |
| Exact Mass | 449.97100 |
| LogP | 5.71770 |
| InChIKey | OXQHQHZMHCGTFY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|
|
~%
1,1,2,2,3,3,4,4... CAS#:423-02-9 |
| Literature: Barlow; Tatlow Journal of the Chemical Society, 1952 , p. 4695,4698 |
|
~34%
1,1,2,2,3,3,4,4... CAS#:423-02-9 |
| Literature: Lin, Wen-Huey; Lagow, Richard J. Journal of Fluorine Chemistry, 1990 , vol. 50, # 3 p. 345 - 358 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| perfluoro-i-propylcyclohexane |
| Perfluorisopropylcyclohexan |
| 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(heptafluoropropan-2-yl)cyclohexane |
| F-2-Cyclohexylpropane |
| Cyclohexane,undecafluoro[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl] |
| Undecafluor-heptafluorisopropyl-cyclohexan |
| perfluoro isopropyl cyclohexane |
| Octadecafluoro(isopropylcyclohexane) |
| undecafluoro-heptafluoroisopropyl-cyclohexane |
| (1,1,1,2,3,3,3-Heptafluoroprop-2-yl)undecafluorocyclohexane |