N-[4-[(6-aminopurin-9-yl)methyl]phenyl]-2-bromoacetamide
Modify Date: 2025-09-12 12:43:16
![N-[4-[(6-aminopurin-9-yl)methyl]phenyl]-2-bromoacetamide Structure](https://image.chemsrc.com/caspic/441/4230-23-3.png)
N-[4-[(6-aminopurin-9-yl)methyl]phenyl]-2-bromoacetamide structure
|
Common Name | N-[4-[(6-aminopurin-9-yl)methyl]phenyl]-2-bromoacetamide | ||
|---|---|---|---|---|
| CAS Number | 4230-23-3 | Molecular Weight | 361.19700 | |
| Density | 1.73g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13BrN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[(6-aminopurin-9-yl)methyl]phenyl]-2-bromoacetamide |
|---|
| Density | 1.73g/cm3 |
|---|---|
| Molecular Formula | C14H13BrN6O |
| Molecular Weight | 361.19700 |
| Exact Mass | 360.03300 |
| PSA | 98.72000 |
| LogP | 2.44440 |
| Index of Refraction | 1.76 |
| InChIKey | MLENUZNNXIORHN-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1ncn2Cc1ccc(NC(=O)CBr)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |