6-diethoxyphosphoryl-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-diethoxyphosphoryl-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 4230-55-1 | Molecular Weight | 247.19200 | |
| Density | 1.37g/cm3 | Boiling Point | 462.5ºC at 760 mmHg | |
| Molecular Formula | C7H14N5O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.5ºC | |
| Name | 6-diethoxyphosphoryl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 462.5ºC at 760 mmHg |
| Molecular Formula | C7H14N5O3P |
| Molecular Weight | 247.19200 |
| Flash Point | 233.5ºC |
| Exact Mass | 247.08300 |
| PSA | 136.05000 |
| LogP | 1.08980 |
| Index of Refraction | 1.537 |
| InChIKey | DDMIIIHVHWXZLV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)c1nc(N)nc(N)n1 |
| HS Code | 2933699090 |
|---|
|
~%
6-diethoxyphosp... CAS#:4230-55-1 |
| Literature: Hu; Yang Synthetic Communications, 2001 , vol. 31, # 24 p. 3817 - 3827 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| diethyl 4,6-diamino-1,3,5-triazine-2-yl phosphonate |