3-(2-phenylacetyl)benzoic acid structure
|
Common Name | 3-(2-phenylacetyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 423151-69-3 | Molecular Weight | 240.25400 | |
| Density | 1.237g/cm3 | Boiling Point | 449.5ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | 3-(2-phenylacetyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 239.8ºC |
| Exact Mass | 240.07900 |
| PSA | 54.37000 |
| LogP | 2.81020 |
| Index of Refraction | 1.614 |
| InChIKey | AQVBEISJPKPDAH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(C(=O)Cc2ccccc2)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(1-oxo-2-phenylethyl)benzoic acid |