2-[(5-methylfuran-2-carbonyl)amino]benzoic acid
Modify Date: 2025-08-29 14:24:10
![2-[(5-methylfuran-2-carbonyl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/063/423729-45-7.png)
2-[(5-methylfuran-2-carbonyl)amino]benzoic acid structure
|
Common Name | 2-[(5-methylfuran-2-carbonyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 423729-45-7 | Molecular Weight | 245.23100 | |
| Density | 1.363g/cm3 | Boiling Point | 343.8ºC at 760 mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.7ºC | |
| Name | 2-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
|---|
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 343.8ºC at 760 mmHg |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 161.7ºC |
| Exact Mass | 245.06900 |
| PSA | 79.54000 |
| LogP | 2.61150 |
| Index of Refraction | 1.64 |
| InChIKey | JWHIXBPRNNMOHQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)O)o1 |
| HS Code | 2932190090 |
|---|
|
~%
2-[(5-methylfur... CAS#:423729-45-7 |
| Literature: Pappalardo; Tornetta Bollettino delle Sedute della Accademia Gioenia di Scienze Naturali in Catania, 1955 , vol. <4> 3, p. 59,60 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |