N-(3-hydroxyphenyl)-5-methylfuran-2-carboxamide
Modify Date: 2025-10-07 23:35:35
N-(3-hydroxyphenyl)-5-methylfuran-2-carboxamide structure
|
Common Name | N-(3-hydroxyphenyl)-5-methylfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 423730-64-7 | Molecular Weight | 217.22100 | |
| Density | 1.31g/cm3 | Boiling Point | 301.7ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | N-(3-hydroxyphenyl)-5-methylfuran-2-carboxamide |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 301.7ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 136.3ºC |
| Exact Mass | 217.07400 |
| PSA | 62.47000 |
| LogP | 2.61890 |
| Index of Refraction | 1.641 |
| InChIKey | RUCCQIHGQRRLHW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Nc2cccc(O)c2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |