CTX-0124143 structure
|
Common Name | CTX-0124143 | ||
|---|---|---|---|---|
| CAS Number | 423731-64-0 | Molecular Weight | 344.360 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H13FN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CTX-0124143CTX-0124143 is a KAT6A inhibitor with a sulfonyl hydrazine skeleton[1]. |
| Name | 2-Fluoro-N'-(2-naphthylsulfonyl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Description | CTX-0124143 is a KAT6A inhibitor with a sulfonyl hydrazine skeleton[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.360 |
| Exact Mass | 344.063080 |
| LogP | 2.85 |
| Index of Refraction | 1.651 |
| InChIKey | CMGWGSMHPCWLOH-UHFFFAOYSA-N |
| SMILES | O=C(NNS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1F |
| Benzoic acid, 2-fluoro-, 2-(2-naphthalenylsulfonyl)hydrazide |
| 2-Fluoro-N'-(2-naphthylsulfonyl)benzohydrazide |