3-(2,4-diethoxyphenyl)prop-2-enoic acid structure
|
Common Name | 3-(2,4-diethoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 423736-06-5 | Molecular Weight | 236.26400 | |
| Density | 1.146g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
| Name | 3-(2,4-diethoxyphenyl)prop-2-enoic acid |
|---|
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 153.1ºC |
| Exact Mass | 236.10500 |
| PSA | 55.76000 |
| LogP | 2.58180 |
| Index of Refraction | 1.556 |
| InChIKey | OCSURSYLLPHFLE-SOFGYWHQSA-N |
| SMILES | CCOc1ccc(C=CC(=O)O)c(OCC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |