3-(2-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid structure
|
Common Name | 3-(2-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 423747-21-1 | Molecular Weight | 301.13300 | |
| Density | 1.463g/cm3 | Boiling Point | 419.4ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.4ºC | |
| Name | 3-(2-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoic acid |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 419.4ºC at 760 mmHg |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.13300 |
| Flash Point | 207.4ºC |
| Exact Mass | 300.00000 |
| PSA | 55.76000 |
| LogP | 2.95420 |
| Index of Refraction | 1.589 |
| InChIKey | ODEMKAOVDNZVQG-SNAWJCMRSA-N |
| SMILES | CCOc1cc(C=CC(=O)O)c(Br)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |