3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid
Modify Date: 2025-10-04 09:03:34
3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid structure
|
Common Name | 3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 423748-18-9 | Molecular Weight | 287.10700 | |
| Density | 1.517g/cm3 | Boiling Point | 431.4ºC at 760 mmHg | |
| Molecular Formula | C11H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.7ºC | |
| Name | 3-(5-bromo-2,4-dimethoxyphenyl)prop-2-enoic acid |
|---|
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760 mmHg |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.10700 |
| Flash Point | 214.7ºC |
| Exact Mass | 285.98400 |
| PSA | 55.76000 |
| LogP | 2.56410 |
| Index of Refraction | 1.6 |
| InChIKey | BWWHSNRSZPESIE-ONEGZZNKSA-N |
| SMILES | COc1cc(OC)c(C=CC(=O)O)cc1Br |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |