L-proline-L-leucine methyl ester
Modify Date: 2025-12-31 18:33:51
L-proline-L-leucine methyl ester structure
|
Common Name | L-proline-L-leucine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 42382-99-0 | Molecular Weight | 242.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-proline-L-leucine methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N2O3 |
|---|---|
| Molecular Weight | 242.31500 |
| Exact Mass | 242.16300 |
| PSA | 67.43000 |
| LogP | 1.16200 |
| InChIKey | HSPZQEUPIFQDCJ-UWVGGRQHSA-N |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1CCCN1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| prolylleucine methyl ester |
| L-Pro-L-Leu methyl ester |
| Pro-Leu-OMe |
| L-prolyl-L-leucine methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does L-proline-L-leucine methyl ester have? |
| A: English synonyms of L-proline-L-leucine methyl ester: prolylleucine methyl ester, L-Pro-L-Leu methyl ester, Pro-Leu-OMe, L-prolyl-L-leucine methyl ester. |
| Q: What is the CAS number of L-proline-L-leucine methyl ester? |
| A: CAS number of L-proline-L-leucine methyl ester is 42382-99-0. |
| Q: What is the SMILES notation of L-proline-L-leucine methyl ester? |
| A: SMILES notation of L-proline-L-leucine methyl ester is COC(=O)C(CC(C)C)NC(=O)C1CCCN1. |
| Q: What is the English name of L-proline-L-leucine methyl ester? |
| A: The English name of L-proline-L-leucine methyl ester is L-proline-L-leucine methyl ester. |
| Q: What is the Chinese name of 42382-99-0? |
| A: Chinese name of 42382-99-0 is 42382-99-0. |
| Q: What is the LogP of L-proline-L-leucine methyl ester? |
| A: LogP of L-proline-L-leucine methyl ester is 1.16200. |
| Q: What is the molecular formula of L-proline-L-leucine methyl ester? |
| A: Molecular formula of L-proline-L-leucine methyl ester is C12H22N2O3. |
| Q: What is the polar surface area (PSA) of L-proline-L-leucine methyl ester? |
| A: Polar surface area (PSA) of L-proline-L-leucine methyl ester is 67.43000. |
| Q: What is the InChIKey of L-proline-L-leucine methyl ester? |
| A: InChIKey of L-proline-L-leucine methyl ester is HSPZQEUPIFQDCJ-UWVGGRQHSA-N. |
| Q: What is the molecular weight of L-proline-L-leucine methyl ester? |
| A: Molecular weight of L-proline-L-leucine methyl ester is 242.31500. |