Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy
Modify Date: 2025-10-31 16:01:12
Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy structure
|
Common Name | Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 424-87-3 | Molecular Weight | 360.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H25FO4 |
|---|---|
| Molecular Weight | 360.4 |
| InChIKey | OZSDFGFTFUXIKM-ZOLGCQAOSA-N |
| SMILES | CC12CC(=O)C3(F)C(CCC4=CC(=O)C=CC43C)C1CCC2C(=O)CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 424-87-3? |
| A: Chinese name of 424-87-3 is 424-87-3. |
| Q: What is the molecular weight of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: Molecular weight of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is 360.4. |
| Q: What is the CAS number of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: CAS number of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is 424-87-3. |
| Q: What is the InChIKey of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: InChIKey of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is OZSDFGFTFUXIKM-ZOLGCQAOSA-N. |
| Q: What is the English name of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: The English name of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy. |
| Q: What is the SMILES notation of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: SMILES notation of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is CC12CC(=O)C3(F)C(CCC4=CC(=O)C=CC43C)C1CCC2C(=O)CO. |
| Q: What is the molecular formula of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy? |
| A: Molecular formula of Pregna-1,4-diene-3,11,20-trione, 9-fluoro-21-hydroxy is C21H25FO4. |