(2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate
Modify Date: 2025-11-24 16:42:46
(2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate structure
|
Common Name | (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate | ||
|---|---|---|---|---|
| CAS Number | 42406-75-7 | Molecular Weight | 265.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.35 |
| InChIKey | FNWODCNOJWSUQB-YPMHNXCESA-N |
| SMILES | CC(OC(C)(C)C)C(N)C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: CAS number of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is 42406-75-7. |
| Q: What is the SMILES notation of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: SMILES notation of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is CC(OC(C)(C)C)C(N)C(=O)OCc1ccccc1. |
| Q: What is the English name of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: The English name of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate. |
| Q: What is the molecular formula of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: Molecular formula of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is C15H23NO3. |
| Q: What is the molecular weight of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: Molecular weight of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is 265.35. |
| Q: What is the Chinese name of 42406-75-7? |
| A: Chinese name of 42406-75-7 is 42406-75-7. |
| Q: What is the InChIKey of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate? |
| A: InChIKey of (2S,3R)-Benzyl 2-amino-3-(tert-butoxy)butanoate is FNWODCNOJWSUQB-YPMHNXCESA-N. |