2-fluoroethyl 2-(4-nitrophenyl)acetate structure
|
Common Name | 2-fluoroethyl 2-(4-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 4242-30-2 | Molecular Weight | 227.18900 | |
| Density | 1.29g/cm3 | Boiling Point | 341.9ºC at 760 mmHg | |
| Molecular Formula | C10H10FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.6ºC | |
| Name | 2-fluoroethyl 2-(4-nitrophenyl)acetate |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 341.9ºC at 760 mmHg |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.18900 |
| Flash Point | 160.6ºC |
| Exact Mass | 227.05900 |
| PSA | 72.12000 |
| LogP | 2.17320 |
| Index of Refraction | 1.52 |
| InChIKey | GTCNCFMJBMQOJT-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)OCCF |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |