Hyrtioerectine B
Modify Date: 2026-04-02 08:00:50
Hyrtioerectine B structure
|
Common Name | Hyrtioerectine B | ||
|---|---|---|---|---|
| CAS Number | 42438-95-9 | Molecular Weight | 246.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Hyrtioerectine B |
|---|
| Molecular Formula | C13H14N2O3 |
|---|---|
| Molecular Weight | 246.26 |
| InChIKey | WYQWRMWMBQUYSD-KSBSHMNSSA-N |
| SMILES | C[C@@H]1C2=C(C[C@@H](N1)C(=O)O)C3=C(N2)C=CC(=C3)O |
|
Name: Anticancer activity against human HeLa cells assessed as inhibition of cell growth
Source: ChEMBL
Target: HeLa
External Id: CHEMBL5151235
|
|
Name: Cytotoxicity against human HeLa cells at 50 ug/mL
Source: ChEMBL
Target: HeLa
External Id: CHEMBL2049707
|
|
Name: Cytotoxicity against human HeLa cells by Fukuzawa's method
Source: ChEMBL
Target: HeLa
External Id: CHEMBL1008632
|
|
Name: Inhibition of FLAG-tagged ubiquitin-activating enzyme E1 assessed as inhibition of GS...
Source: ChEMBL
Target: Ubiquitin-like modifier-activating enzyme 1
External Id: CHEMBL2050671
|
Total 4, Current Page 1 of 1
1