Trimethyl(2-methyl-1H-inden-1-yl)silane structure
|
Common Name | Trimethyl(2-methyl-1H-inden-1-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 42466-59-1 | Molecular Weight | 202.367 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 270.5±19.0 °C at 760 mmHg | |
| Molecular Formula | C13H18Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1±15.1 °C | |
| Name | 1h-2-methylindenyl-1-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.5±19.0 °C at 760 mmHg |
| Molecular Formula | C13H18Si |
| Molecular Weight | 202.367 |
| Flash Point | 103.1±15.1 °C |
| Exact Mass | 202.117783 |
| LogP | 5.01 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | YGJQQDPQBLYNAU-UHFFFAOYSA-N |
| SMILES | CC1=Cc2ccccc2C1[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-Trimethylsilyl-2-methylinden |
| 1-trimethylsilyl-2-methylindene |
| Trimethyl(2-methyl-1H-inden-1-yl)silane |
| 3-(trimethylsilyl)-2,5-dihydrofuran |
| Silane,(2,5-dihydro-3-furanyl)trimethyl |
| 1H-Indene, 2-methyl-1-(trimethylsilyl)- |